| Name | Disperse Orange 1 |
| Synonyms | CI 11080 C.I. 11080 DISPERSE ORANGE 1 Disperse Orange 1 C.I. Disperse Orange 1 disperse orange 1 (C.I. 11080) 4-(4-Nitrophenylazo)diphenylamine 4-(p-nitrophenylazo)diphenylamine 4-((p-nitrophenyl)azo)-diphenylamin 4-((p-nitrophenyl)azo)diphenylamine 4-[(4-nitrophenyl)azo]-n-phenyl-benzenamin 4-((4-nitrophenyl)azo)-n-phenyl-benzenamin 4-[(4-nitrophenyl)azo]-N-phenyl-Benzenamine 4-[(E)-(4-nitrophenyl)diazenyl]-N-phenylaniline |
| CAS | 2581-69-3 |
| EINECS | 219-954-6 |
| InChI | InChI=1/C18H14N4O2/c23-22(24)18-12-10-17(11-13-18)21-20-16-8-6-15(7-9-16)19-14-4-2-1-3-5-14/h1-13,19H/b21-20+ |
| Molecular Formula | C18H14N4O2 |
| Molar Mass | 318.33 |
| Density | 1.2846 (rough estimate) |
| Melting Point | 160 °C |
| Boling Point | 457.5°C (rough estimate) |
| Flash Point | 277.4°C |
| Water Solubility | 0.4775ug/L(25 ºC) |
| Solubility | DMSO (Slightly, Sonicated), Methanol (Slightly, Sonicated) |
| Vapor Presure | 1.6E-11mmHg at 25°C |
| Appearance | neat |
| Color | Dark Purple to Very Dark Purple |
| pKa | -0.60±0.40(Predicted) |
| Storage Condition | Refrigerator, under inert atmosphere |
| Refractive Index | 1.6700 (estimate) |
| MDL | MFCD00007311 |
| Hazard Symbols | Xn - Harmful![]() |
| Risk Codes | R36/37/38 - Irritating to eyes, respiratory system and skin. R22 - Harmful if swallowed |
| Safety Description | S37/39 - Wear suitable gloves and eye/face protection S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| RTECS | JJ9700000 |
| FLUKA BRAND F CODES | 10-21 |
| HS Code | 32041100 |
| color index | 11080 |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |